2-Tert-Butyl-4-methoxyphenol
| Common Name: |
2-Tert-Butyl-4-methoxyphenol |
| IUPAC Name: |
2-tert-butyl-4-methoxyphenol |
| Molecular Formula: |
C11H16O2 |
| SMILES: |
CC(C)(C)C1=C(C=CC(=C1)OC)O |
| Inchi: |
1S/C11H16O2/c1-11(2,3)9-7-8(13-4)5-6-10(9)12/h5-7,12H,1-4H3 |
| Inchi Key: |
MRBKEAMVRSLQPH-UHFFFAOYSA-N |
| Cas No: |
25013-16-5 |
| Name |
Value |
| Lipinski Violations |
0 |
| Ghose Violations |
0 |
| Veber Violations |
0 |
| Egan Violations |
0 |
| Muegge Violations |
1 |
| Name |
Value |
| Molecular Weight (g/mol) |
180.24 |
| Mass (g/mol) |
180.115 |
| Molar Refractivity |
54.23 |
| Net Charge |
|
| HBD |
1 |
| HBA |
2 |
| Rt Bonds |
2 |
| Rings |
1 |
| TPSA |
29.46 |
| Hetero Atoms |
2 |
| Heavy Atoms |
13 |
| Aromatic Heavy Atoms |
6 |
| Melting Point (°C) |
58.00 to 60.00 |
| Boiling Point (°C@760.00mm Hg) |
268.00 to 269.00 |
| Vapor Pressure (mmHg@25.00 °C) |
0.004 |
| Vapor Density (Air =1) |
6.2 |
| Fraction Csp3 |
0.45 |
| LogP |
2.698 |
| iLOGP |
2.55 |
| XLOGP3 |
3.15 |
| WLOGP |
2.70 |
| MLOGP |
2.39 |
| ESOL Log S |
-3.15 |
| ESOL Solubility (mg/ml) |
0.127 |
| ESOL Solubility (mol/l) |
0.001 |
| ESOL Class: esol_class |
Soluble |
| Ali Log S |
-3.44 |
| Ali Solubility (mg/ml) |
0.07 |
| Ali Solubility (mol/l) |
0 |
| Ali Class |
Soluble |
| Silicos-IT LogSw |
-3.16 |
| Silicos-IT Solubility (mg/ml) |
0.13 |
| Silicos-IT Solubility (mol/l) |
0 |
| Silicos-IT Class |
Soluble |
| Name |
Value |
| GI Absorption |
High |
| BBB Permeable |
1 |
| PgP Substrate |
0 |
| Log Kp (cm/s) |
-5.16 |
| Bioavailability Score |
0.55 |
| Caco2 |
1 |
| Human Intestinal Absorption |
1 |
| Plasm Protein Binding |
0.952 |
| CYP1A2 Inhibitor |
1 |
| CYP2C19 Inhibitor |
0 |
| CYP2C9 Inhibitor |
0 |
| CYP2D6 inhibitor |
0 |
| CYP3A4 inhibitor |
0 |
| Ames mutagenesis |
0 |
| Acute Oral Toxicity |
1.914 |
| Carcinogenicity (Binary) |
0 |
| Carcinogenicity (Trinary) |
Non-required |
| Eye Irritation |
1 |
| Hepatotoxicity |
0 |
| Androgen Receptor Binding |
1 |
| Aromatase Binding |
0 |
| Estrogen Receptor Binding |
0 |
| Glucocorticoid Receptor Binding |
0 |
| Thyroid Receptor Binding |
0 |
| BRCP inhibitor |
0 |
| BSEP inhibitor |
0 |
| OATP1B1 inhibitor |
1 |
| OATP1B3 inhibitor |
1 |
| OATP2B1 inhibitor |
0 |
| OCT1 inhibitor |
0 |
| OCT2 inhibitor |
0 |
